C10H14N2O2 — CID 143892741
ethane;5-methoxy-1,3-dihydrobenzimidazol-2-one (PubChem CID 143892741) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is ethane;5-methoxy-1,3-dihydrobenzimidazol-2-one.
| Compound Name | ethane;5-methoxy-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 143892741 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethane;5-methoxy-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC.COc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H8N2O2.C2H6/c1-12-5-2-3-6-7(4-5)10-8(11)9-6;1-2/h2-4H,1H3,(H2,9,10,11);1-2H3 |
| InChIKey | OINOOMRNFBPMEY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |