C14H12N2O5S — CID 71902122
(3-methoxyphenyl) 2-oxo-1,3-dihydrobenzimidazole-5-sulfonate (PubChem CID 71902122) has the molecular formula C14H12N2O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is (3-methoxyphenyl) 2-oxo-1,3-dihydrobenzimidazole-5-sulfonate.
| Compound Name | (3-methoxyphenyl) 2-oxo-1,3-dihydrobenzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 71902122 |
| Molecular Formula | C14H12N2O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (3-methoxyphenyl) 2-oxo-1,3-dihydrobenzimidazole-5-sulfonate |
| SMILES | COc1cccc(OS(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C14H12N2O5S/c1-20-9-3-2-4-10(7-9)21-22(18,19)11-5-6-12-13(8-11)16-14(17)15-12/h2-8H,1H3,(H2,15,16,17) |
| InChIKey | OBSOYCGLKCYADS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|