C17H16N2O5S — CID 52565592
(3-propan-2-ylphenyl) 2,4-dioxo-1H-quinazoline-6-sulfonate (PubChem CID 52565592) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (3-propan-2-ylphenyl) 2,4-dioxo-1H-quinazoline-6-sulfonate.
| Compound Name | (3-propan-2-ylphenyl) 2,4-dioxo-1H-quinazoline-6-sulfonate |
|---|---|
| PubChem CID | 52565592 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (3-propan-2-ylphenyl) 2,4-dioxo-1H-quinazoline-6-sulfonate |
| SMILES | CC(C)c1cccc(OS(=O)(=O)c2ccc3[nH]c(=O)[nH]c(=O)c3c2)c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-10(2)11-4-3-5-12(8-11)24-25(22,23)13-6-7-15-14(9-13)16(20)19-17(21)18-15/h3-10H,1-2H3,(H2,18,19,20,21) |
| InChIKey | BNSIBNXVQUTAQY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|