C22H17N3O6S — CID 55559997
[3-(benzylcarbamoyl)phenyl] 2,4-dioxo-1H-quinazoline-6-sulfonate (PubChem CID 55559997) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 2,4-dioxo-1H-quinazoline-6-sulfonate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 2,4-dioxo-1H-quinazoline-6-sulfonate |
|---|---|
| PubChem CID | 55559997 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 2,4-dioxo-1H-quinazoline-6-sulfonate |
| SMILES | O=C(NCc1ccccc1)c1cccc(OS(=O)(=O)c2ccc3[nH]c(=O)[nH]c(=O)c3c2)c1 |
| InChI | InChI=1S/C22H17N3O6S/c26-20(23-13-14-5-2-1-3-6-14)15-7-4-8-16(11-15)31-32(29,30)17-9-10-19-18(12-17)21(27)25-22(28)24-19/h1-12H,13H2,(H,23,26)(H2,24,25,27,28) |
| InChIKey | DYJSUBJBWIXDRV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|