C19H14Cl2N2O4S — CID 71905444
[3-(benzylcarbamoyl)phenyl] 4,6-dichloropyridine-3-sulfonate (PubChem CID 71905444) has the molecular formula C19H14Cl2N2O4S and a molecular weight of 437.30 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 4,6-dichloropyridine-3-sulfonate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 4,6-dichloropyridine-3-sulfonate |
|---|---|
| PubChem CID | 71905444 |
| Molecular Formula | C19H14Cl2N2O4S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 4,6-dichloropyridine-3-sulfonate |
| SMILES | O=C(NCc1ccccc1)c1cccc(OS(=O)(=O)c2cnc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H14Cl2N2O4S/c20-16-10-18(21)22-12-17(16)28(25,26)27-15-8-4-7-14(9-15)19(24)23-11-13-5-2-1-3-6-13/h1-10,12H,11H2,(H,23,24) |
| InChIKey | IHRJQUGXVXODFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|