C15H13F3O6S — CID 31776008
(3,5-dimethoxyphenyl) 3-(trifluoromethoxy)benzenesulfonate (PubChem CID 31776008) has the molecular formula C15H13F3O6S and a molecular weight of 378.32 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) 3-(trifluoromethoxy)benzenesulfonate.
| Compound Name | (3,5-dimethoxyphenyl) 3-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 31776008 |
| Molecular Formula | C15H13F3O6S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | (3,5-dimethoxyphenyl) 3-(trifluoromethoxy)benzenesulfonate |
| SMILES | COc1cc(OC)cc(OS(=O)(=O)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H13F3O6S/c1-21-11-6-12(22-2)8-13(7-11)24-25(19,20)14-5-3-4-10(9-14)23-15(16,17)18/h3-9H,1-2H3 |
| InChIKey | SWSAUORXTRUXNB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|