C27H23F3O11S — CID 175124931
[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl] 3-(trifluoromethoxy)benzenesulfonate (PubChem CID 175124931) has the molecular formula C27H23F3O11S and a molecular weight of 612.53 g/mol. Its IUPAC name is [5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl] 3-(trifluoromethoxy)benzenesulfonate.
| Compound Name | [5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl] 3-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 175124931 |
| Molecular Formula | C27H23F3O11S |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | [5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl] 3-(trifluoromethoxy)benzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OS(=O)(=O)c3cccc(OC(F)(F)F)c3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C27H23F3O11S/c1-34-16-12-18(35-2)22-19(13-16)39-24(14-9-20(36-3)25(38-5)21(10-14)37-4)26(23(22)31)41-42(32,33)17-8-6-7-15(11-17)40-27(28,29)30/h6-13H,1-5H3 |
| InChIKey | NPZHHFUVQMSZID-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 128.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|