C30H32ClNO8 — CID 174051115
3-[1-(6-chloro-3-pyridinyl)pentan-2-yloxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 174051115) has the molecular formula C30H32ClNO8 and a molecular weight of 570.04 g/mol. Its IUPAC name is 3-[1-(6-chloro-3-pyridinyl)pentan-2-yloxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[1-(6-chloro-3-pyridinyl)pentan-2-yloxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 174051115 |
| Molecular Formula | C30H32ClNO8 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 3-[1-(6-chloro-3-pyridinyl)pentan-2-yloxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | CCCC(Cc1ccc(Cl)nc1)Oc1c(-c2cc(OC)c(OC)c(OC)c2)oc2cc(OC)cc(OC)c2c1=O |
| InChI | InChI=1S/C30H32ClNO8/c1-7-8-19(11-17-9-10-25(31)32-16-17)39-30-27(33)26-21(35-3)14-20(34-2)15-22(26)40-28(30)18-12-23(36-4)29(38-6)24(13-18)37-5/h9-10,12-16,19H,7-8,11H2,1-6H3 |
| InChIKey | CZQQNIFQKPZLDW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|