C16H15F3N2O6S — CID 24662326
3,5-dimethoxy-N'-[3-(trifluoromethoxy)phenyl]sulfonylbenzohydrazide (PubChem CID 24662326) has the molecular formula C16H15F3N2O6S and a molecular weight of 420.37 g/mol. Its IUPAC name is 3,5-dimethoxy-N'-[3-(trifluoromethoxy)phenyl]sulfonylbenzohydrazide.
| Compound Name | 3,5-dimethoxy-N'-[3-(trifluoromethoxy)phenyl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 24662326 |
| Molecular Formula | C16H15F3N2O6S |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 3,5-dimethoxy-N'-[3-(trifluoromethoxy)phenyl]sulfonylbenzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNS(=O)(=O)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3N2O6S/c1-25-12-6-10(7-13(8-12)26-2)15(22)20-21-28(23,24)14-5-3-4-11(9-14)27-16(17,18)19/h3-9,21H,1-2H3,(H,20,22) |
| InChIKey | BUAYNLDMACEOMC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|