C13H11F3N2O5S — CID 24662232
2-methyl-N'-[3-(trifluoromethoxy)phenyl]sulfonylfuran-3-carbohydrazide (PubChem CID 24662232) has the molecular formula C13H11F3N2O5S and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-methyl-N'-[3-(trifluoromethoxy)phenyl]sulfonylfuran-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[3-(trifluoromethoxy)phenyl]sulfonylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 24662232 |
| Molecular Formula | C13H11F3N2O5S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-methyl-N'-[3-(trifluoromethoxy)phenyl]sulfonylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNS(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N2O5S/c1-8-11(5-6-22-8)12(19)17-18-24(20,21)10-4-2-3-9(7-10)23-13(14,15)16/h2-7,18H,1H3,(H,17,19) |
| InChIKey | UUKRKASJFQZWCZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|