C17H17F3N2O4S2 — CID 31777309
N'-[3-(trifluoromethoxy)phenyl]sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide (PubChem CID 31777309) has the molecular formula C17H17F3N2O4S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is N'-[3-(trifluoromethoxy)phenyl]sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(trifluoromethoxy)phenyl]sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 31777309 |
| Molecular Formula | C17H17F3N2O4S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N'-[3-(trifluoromethoxy)phenyl]sulfonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccc(OC(F)(F)F)c1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C17H17F3N2O4S2/c18-17(19,20)26-12-6-4-7-13(10-12)28(24,25)22-21-16(23)15-9-11-5-2-1-3-8-14(11)27-15/h4,6-7,9-10,22H,1-3,5,8H2,(H,21,23) |
| InChIKey | PXYQTCWCGXLOSY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|