C25H20N2+2 — CID 59087655
6-methyl-8-(6H-pyrido[2,1-a]isoindol-5-ium-8-yl)-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 59087655) has the molecular formula C25H20N2+2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 6-methyl-8-(6H-pyrido[2,1-a]isoindol-5-ium-8-yl)-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 6-methyl-8-(6H-pyrido[2,1-a]isoindol-5-ium-8-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 59087655 |
| Molecular Formula | C25H20N2+2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 6-methyl-8-(6H-pyrido[2,1-a]isoindol-5-ium-8-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | CC1c2cc(-c3ccc4c(c3)C[n+]3ccccc3-4)ccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C25H20N2/c1-17-23-15-19(9-11-22(23)25-7-3-5-13-27(17)25)18-8-10-21-20(14-18)16-26-12-4-2-6-24(21)26/h2-15,17H,16H2,1H3/q+2 |
| InChIKey | UMGBWQZBXLCPLX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|