C18H16NS+ — CID 58435128
6-methyl-9-(5-methylthiophen-2-yl)-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 58435128) has the molecular formula C18H16NS+ and a molecular weight of 278.40 g/mol. Its IUPAC name is 6-methyl-9-(5-methylthiophen-2-yl)-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 6-methyl-9-(5-methylthiophen-2-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 58435128 |
| Molecular Formula | C18H16NS+ |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 6-methyl-9-(5-methylthiophen-2-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1ccc(-c2ccc3c(c2)-c2cccc[n+]2C3C)s1 |
| InChI | InChI=1S/C18H16NS/c1-12-6-9-18(20-12)14-7-8-15-13(2)19-10-4-3-5-17(19)16(15)11-14/h3-11,13H,1-2H3/q+1 |
| InChIKey | KANKQUWFISIEAO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|