C14H14N+ — CID 59725414
3,6-dimethyl-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 59725414) has the molecular formula C14H14N+ and a molecular weight of 196.27 g/mol. Its IUPAC name is 3,6-dimethyl-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 3,6-dimethyl-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 59725414 |
| Molecular Formula | C14H14N+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3,6-dimethyl-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1ccc2[n+](c1)C(C)c1ccccc1-2 |
| InChI | InChI=1S/C14H14N/c1-10-7-8-14-13-6-4-3-5-12(13)11(2)15(14)9-10/h3-9,11H,1-2H3/q+1 |
| InChIKey | XAXFEFZAXJDVAS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|