C26H22N2+2 — CID 91801370
4-methyl-6-(4-methyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 91801370) has the molecular formula C26H22N2+2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-methyl-6-(4-methyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 4-methyl-6-(4-methyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 91801370 |
| Molecular Formula | C26H22N2+2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-methyl-6-(4-methyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1cccc2[n+]1C(C1c3ccccc3-c3cccc(C)[n+]31)c1ccccc1-2 |
| InChI | InChI=1S/C26H22N2/c1-17-9-7-15-23-19-11-3-5-13-21(19)25(27(17)23)26-22-14-6-4-12-20(22)24-16-8-10-18(2)28(24)26/h3-16,25-26H,1-2H3/q+2 |
| InChIKey | VQCCWPJNHKMROY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|