C34H29BN2+2 — CID 172603767
14-(2,4,6-trimethylphenyl)-27,28-diazonia-14-boraheptacyclo[13.11.1.12,9.03,8.019,27.020,25.013,28]octacosa-3,5,7,9,11,13(28),15(27),16,18,20,22,24-dodecaene (PubChem CID 172603767) has the molecular formula C34H29BN2+2 and a molecular weight of 476.43 g/mol. Its IUPAC name is 14-(2,4,6-trimethylphenyl)-27,28-diazonia-14-boraheptacyclo[13.11.1.12,9.03,8.019,27.020,25.013,28]octacosa-3,5,7,9,11,13(28),15(27),16,18,20,22,24-dodecaene.
| Compound Name | 14-(2,4,6-trimethylphenyl)-27,28-diazonia-14-boraheptacyclo[13.11.1.12,9.03,8.019,27.020,25.013,28]octacosa-3,5,7,9,11,13(28),15(27),16,18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 172603767 |
| Molecular Formula | C34H29BN2+2 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 14-(2,4,6-trimethylphenyl)-27,28-diazonia-14-boraheptacyclo[13.11.1.12,9.03,8.019,27.020,25.013,28]octacosa-3,5,7,9,11,13(28),15(27),16,18,20,22,24-dodecaene |
| SMILES | Cc1cc(C)c(B2c3cccc4[n+]3C(Cc3ccccc3-4)C3c4ccccc4-c4cccc2[n+]43)c(C)c1 |
| InChI | InChI=1S/C34H29BN2/c1-21-18-22(2)33(23(3)19-21)35-31-16-8-14-28-25-11-5-4-10-24(25)20-30(36(28)31)34-27-13-7-6-12-26(27)29-15-9-17-32(35)37(29)34/h4-19,30,34H,20H2,1-3H3/q+2 |
| InChIKey | COYZHZHSJASSSS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|