C16H18N+ — CID 143953901
4,6,7-trimethyl-6,7-dihydrobenzo[a]quinolizin-5-ium (PubChem CID 143953901) has the molecular formula C16H18N+ and a molecular weight of 224.33 g/mol. Its IUPAC name is 4,6,7-trimethyl-6,7-dihydrobenzo[a]quinolizin-5-ium.
| Compound Name | 4,6,7-trimethyl-6,7-dihydrobenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 143953901 |
| Molecular Formula | C16H18N+ |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4,6,7-trimethyl-6,7-dihydrobenzo[a]quinolizin-5-ium |
| SMILES | Cc1cccc2[n+]1C(C)C(C)c1ccccc1-2 |
| InChI | InChI=1S/C16H18N/c1-11-7-6-10-16-15-9-5-4-8-14(15)12(2)13(3)17(11)16/h4-10,12-13H,1-3H3/q+1 |
| InChIKey | GVBYYJVXJJSCNZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|