C20H18N+ — CID 59904303
1-[(9R,10S)-10-methyl-9,10-dihydrophenanthren-9-yl]pyridin-1-ium (PubChem CID 59904303) has the molecular formula C20H18N+ and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-[(9R,10S)-10-methyl-9,10-dihydrophenanthren-9-yl]pyridin-1-ium.
| Compound Name | 1-[(9R,10S)-10-methyl-9,10-dihydrophenanthren-9-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 59904303 |
| Molecular Formula | C20H18N+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-[(9R,10S)-10-methyl-9,10-dihydrophenanthren-9-yl]pyridin-1-ium |
| SMILES | C[C@H]1c2ccccc2-c2ccccc2[C@@H]1[n+]1ccccc1 |
| InChI | InChI=1S/C20H18N/c1-15-16-9-3-4-10-17(16)18-11-5-6-12-19(18)20(15)21-13-7-2-8-14-21/h2-15,20H,1H3/q+1/t15-,20+/m0/s1 |
| InChIKey | WQQBOGGINWOUFB-MGPUTAFESA-N |
| XLogP | 4.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|