C17H17NO — CID 134969506
N-[(9R,10R)-10-methyl-9,10-dihydrophenanthren-9-yl]acetamide (PubChem CID 134969506) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(9R,10R)-10-methyl-9,10-dihydrophenanthren-9-yl]acetamide.
| Compound Name | N-[(9R,10R)-10-methyl-9,10-dihydrophenanthren-9-yl]acetamide |
|---|---|
| PubChem CID | 134969506 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(9R,10R)-10-methyl-9,10-dihydrophenanthren-9-yl]acetamide |
| SMILES | CC(=O)N[C@H]1c2ccccc2-c2ccccc2[C@H]1C |
| InChI | InChI=1S/C17H17NO/c1-11-13-7-3-4-8-14(13)15-9-5-6-10-16(15)17(11)18-12(2)19/h3-11,17H,1-2H3,(H,18,19)/t11-,17-/m1/s1 |
| InChIKey | NQCNFKQYQVUJHQ-PIGZYNQJSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |