C17H12N2+2 — CID 58321386
(1S)-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene (PubChem CID 58321386) has the molecular formula C17H12N2+2 and a molecular weight of 244.30 g/mol. Its IUPAC name is (1S)-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene.
| Compound Name | (1S)-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 58321386 |
| Molecular Formula | C17H12N2+2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (1S)-2,19-diazoniapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaene |
| SMILES | c1ccc2c(c1)-c1cccc3[n+]1[C@@H]2[n+]1ccccc1-3 |
| InChI | InChI=1S/C17H12N2/c1-2-7-13-12(6-1)14-9-5-10-16-15-8-3-4-11-18(15)17(13)19(14)16/h1-11,17H/q+2/t17-/m0/s1 |
| InChIKey | AJUBYAVUBWAMBT-KRWDZBQOSA-N |
| XLogP | 2.32 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|