C26H24N2+2 — CID 91805887
6-[1-[2-(2-methylphenyl)pyridin-1-ium-1-yl]ethyl]-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 91805887) has the molecular formula C26H24N2+2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 6-[1-[2-(2-methylphenyl)pyridin-1-ium-1-yl]ethyl]-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 6-[1-[2-(2-methylphenyl)pyridin-1-ium-1-yl]ethyl]-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 91805887 |
| Molecular Formula | C26H24N2+2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 6-[1-[2-(2-methylphenyl)pyridin-1-ium-1-yl]ethyl]-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1ccccc1-c1cccc[n+]1C(C)C1c2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C26H24N2/c1-19-11-3-4-12-21(19)24-15-7-9-17-27(24)20(2)26-23-14-6-5-13-22(23)25-16-8-10-18-28(25)26/h3-18,20,26H,1-2H3/q+2 |
| InChIKey | XGSSLFDDXDRWFV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|