C37H32N3+3 — CID 177317757
ethane;2,26,27-triazoniaoctacyclo[12.12.12.02,7.08,13.015,20.021,26.027,32.033,38]octatriaconta-2,4,6,8,10,12,15,17,19,21,23,25,27,29,31,33,35,37-octadecaene (PubChem CID 177317757) has the molecular formula C37H32N3+3 and a molecular weight of 518.68 g/mol. Its IUPAC name is ethane;2,26,27-triazoniaoctacyclo[12.12.12.02,7.08,13.015,20.021,26.027,32.033,38]octatriaconta-2,4,6,8,10,12,15,17,19,21,23,25,27,29,31,33,35,37-octadecaene.
| Compound Name | ethane;2,26,27-triazoniaoctacyclo[12.12.12.02,7.08,13.015,20.021,26.027,32.033,38]octatriaconta-2,4,6,8,10,12,15,17,19,21,23,25,27,29,31,33,35,37-octadecaene |
|---|---|
| PubChem CID | 177317757 |
| Molecular Formula | C37H32N3+3 |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | ethane;2,26,27-triazoniaoctacyclo[12.12.12.02,7.08,13.015,20.021,26.027,32.033,38]octatriaconta-2,4,6,8,10,12,15,17,19,21,23,25,27,29,31,33,35,37-octadecaene |
| SMILES | CC.c1ccc2c(c1)-c1cccc[n+]1C1[n+]3ccccc3-c3ccccc3C2c2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C35H26N3.C2H6/c1-4-16-28-25(13-1)31-19-7-10-22-36(31)35-37-23-11-8-20-32(37)26-14-2-5-17-29(26)34(28)30-18-6-3-15-27(30)33-21-9-12-24-38(33)35;1-2/h1-24,34-35H;1-2H3/q+3; |
| InChIKey | LLMWUHKDLHFFFJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|