C20H16N+ — CID 160634648
2-azoniapentacyclo[10.6.3.02,7.08,21.013,18]henicosa-2,4,6,8,10,12(21),13,15,17-nonaene (PubChem CID 160634648) has the molecular formula C20H16N+ and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-azoniapentacyclo[10.6.3.02,7.08,21.013,18]henicosa-2,4,6,8,10,12(21),13,15,17-nonaene.
| Compound Name | 2-azoniapentacyclo[10.6.3.02,7.08,21.013,18]henicosa-2,4,6,8,10,12(21),13,15,17-nonaene |
|---|---|
| PubChem CID | 160634648 |
| Molecular Formula | C20H16N+ |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-azoniapentacyclo[10.6.3.02,7.08,21.013,18]henicosa-2,4,6,8,10,12(21),13,15,17-nonaene |
| SMILES | c1ccc2c(c1)-c1cccc3c1CCC2[n+]1ccccc1-3 |
| InChI | InChI=1S/C20H16N/c1-2-7-17-15(6-1)14-8-5-9-18-16(14)11-12-20(17)21-13-4-3-10-19(18)21/h1-10,13,20H,11-12H2/q+1 |
| InChIKey | ADRJERAIROQZBI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|