C20H18N+ — CID 58435194
6-methyl-9-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 58435194) has the molecular formula C20H18N+ and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-methyl-9-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 6-methyl-9-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 58435194 |
| Molecular Formula | C20H18N+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 6-methyl-9-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1ccc(-c2ccc3c(c2)-c2cccc[n+]2C3C)cc1 |
| InChI | InChI=1S/C20H18N/c1-14-6-8-16(9-7-14)17-10-11-18-15(2)21-12-4-3-5-20(21)19(18)13-17/h3-13,15H,1-2H3/q+1 |
| InChIKey | AIWIMDZCRVRUGP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|