C33H27N4+ — CID 149104273
8-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4-methyl-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene (PubChem CID 149104273) has the molecular formula C33H27N4+ and a molecular weight of 479.61 g/mol. Its IUPAC name is 8-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4-methyl-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene.
| Compound Name | 8-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4-methyl-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene |
|---|---|
| PubChem CID | 149104273 |
| Molecular Formula | C33H27N4+ |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 8-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-4-methyl-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(16),3,6(11),7,9,12,14-heptaene |
| SMILES | CC1=CC2C1c1cc(-c3nc(-c4ccc(C)cc4)nc(-c4ccc(C)cc4)n3)ccc1-c1cccc[n+]12 |
| InChI | InChI=1S/C33H27N4/c1-20-7-11-23(12-8-20)31-34-32(24-13-9-21(2)10-14-24)36-33(35-31)25-15-16-26-27(19-25)30-22(3)18-29(30)37-17-5-4-6-28(26)37/h4-19,29-30H,1-3H3/q+1 |
| InChIKey | SSUDRYBKMXOHAJ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|