C32H24N2+2 — CID 170081511
3-(8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene (PubChem CID 170081511) has the molecular formula C32H24N2+2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene.
| Compound Name | 3-(8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene |
|---|---|
| PubChem CID | 170081511 |
| Molecular Formula | C32H24N2+2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-(8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene |
| SMILES | c1ccc(-c2ccc3c(c2)C(C2C4c5ccccc5-c5cccc[n+]5C42)[n+]2ccccc2-3)cc1 |
| InChI | InChI=1S/C32H24N2/c1-2-10-21(11-3-1)22-16-17-24-26(20-22)31(33-18-8-6-15-28(24)33)30-29-25-13-5-4-12-23(25)27-14-7-9-19-34(27)32(29)30/h1-20,29-32H/q+2 |
| InChIKey | NWZBXDDCMUEZGN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|