C22H18N+ — CID 146709195
15-methyl-3-methylidene-14-phenyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene (PubChem CID 146709195) has the molecular formula C22H18N+ and a molecular weight of 296.39 g/mol. Its IUPAC name is 15-methyl-3-methylidene-14-phenyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene.
| Compound Name | 15-methyl-3-methylidene-14-phenyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 146709195 |
| Molecular Formula | C22H18N+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 15-methyl-3-methylidene-14-phenyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaene |
| SMILES | C=C1C2c3ccccc3-c3ccc(-c4ccccc4)c(C)[n+]3C12 |
| InChI | InChI=1S/C22H18N/c1-14-21-19-11-7-6-10-18(19)20-13-12-17(15(2)23(20)22(14)21)16-8-4-3-5-9-16/h3-13,21-22H,1H2,2H3/q+1 |
| InChIKey | XVWSXVWVZWEZHV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|