About 1-methyl-2-phenylbenzene;phosphoric acid
1-methyl-2-phenylbenzene;phosphoric acid (PubChem CID 159087333) has the molecular formula C13H15O4P
and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-methyl-2-phenylbenzene;phosphoric acid.
Molecular Properties
| Compound Name | 1-methyl-2-phenylbenzene;phosphoric acid |
| PubChem CID | 159087333 |
| Molecular Formula | C13H15O4P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-methyl-2-phenylbenzene;phosphoric acid |
| SMILES | Cc1ccccc1-c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C13H12.H3O4P/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;1-5(2,3)4/h2-10H,1H3;(H3,1,2,3,4) |
| InChIKey | KBPKJOCCGZVYGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-phenylbenzene;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-phenylbenzene;phosphoric acid?
The IUPAC name of 1-methyl-2-phenylbenzene;phosphoric acid (CID 159087333) is 1-methyl-2-phenylbenzene;phosphoric acid.
What is the SMILES notation for 1-methyl-2-phenylbenzene;phosphoric acid?
The canonical SMILES for 1-methyl-2-phenylbenzene;phosphoric acid is Cc1ccccc1-c1ccccc1.O=P(O)(O)O.
What is the InChIKey of 1-methyl-2-phenylbenzene;phosphoric acid?
The InChIKey is KBPKJOCCGZVYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.H3O4P/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;1-5(2,3)4/h2-10H,1H3;(H3,1,2,3,4).
What are the key properties of 1-methyl-2-phenylbenzene;phosphoric acid?
1-methyl-2-phenylbenzene;phosphoric acid has a molecular weight of 266.23 g/mol, XLogP of 2.73, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-phenylbenzene;phosphoric acid is sourced from PubChem (CID 159087333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).