About 1-methyl-2-phenylbenzene;sulfane;trifluoroborane
1-methyl-2-phenylbenzene;sulfane;trifluoroborane (PubChem CID 175768148) has the molecular formula C13H14BF3S
and a molecular weight of 270.13 g/mol. Its IUPAC name is 1-methyl-2-phenylbenzene;sulfane;trifluoroborane.
Molecular Properties
| Compound Name | 1-methyl-2-phenylbenzene;sulfane;trifluoroborane |
| PubChem CID | 175768148 |
| Molecular Formula | C13H14BF3S |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-methyl-2-phenylbenzene;sulfane;trifluoroborane |
| SMILES | Cc1ccccc1-c1ccccc1.FB(F)F.S |
| InChI | InChI=1S/C13H12.BF3.H2S/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2-1(3)4;/h2-10H,1H3;;1H2 |
| InChIKey | UUNNWGWFPLFSIP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-phenylbenzene;sulfane;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-phenylbenzene;sulfane;trifluoroborane?
The IUPAC name of 1-methyl-2-phenylbenzene;sulfane;trifluoroborane (CID 175768148) is 1-methyl-2-phenylbenzene;sulfane;trifluoroborane.
What is the SMILES notation for 1-methyl-2-phenylbenzene;sulfane;trifluoroborane?
The canonical SMILES for 1-methyl-2-phenylbenzene;sulfane;trifluoroborane is Cc1ccccc1-c1ccccc1.FB(F)F.S.
What is the InChIKey of 1-methyl-2-phenylbenzene;sulfane;trifluoroborane?
The InChIKey is UUNNWGWFPLFSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.BF3.H2S/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2-1(3)4;/h2-10H,1H3;;1H2.
What are the key properties of 1-methyl-2-phenylbenzene;sulfane;trifluoroborane?
1-methyl-2-phenylbenzene;sulfane;trifluoroborane has a molecular weight of 270.13 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-phenylbenzene;sulfane;trifluoroborane is sourced from PubChem (CID 175768148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).