C16H18O6 — CID 67785413
carbonic acid;1,2-dimethyl-3-phenylbenzene (PubChem CID 67785413) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is carbonic acid;1,2-dimethyl-3-phenylbenzene.
| Compound Name | carbonic acid;1,2-dimethyl-3-phenylbenzene |
|---|---|
| PubChem CID | 67785413 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | carbonic acid;1,2-dimethyl-3-phenylbenzene |
| SMILES | Cc1cccc(-c2ccccc2)c1C.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C14H14.2CH2O3/c1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13;2*2-1(3)4/h3-10H,1-2H3;2*(H2,2,3,4) |
| InChIKey | KTULZGXDXZHTKN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |