C44H41B — CID 101218148
5-[2,6-bis(3,5-dimethylphenyl)phenyl]-6-(3,5-dimethylphenyl)-2,4-dimethylbenzo[b][1]benzoborole (PubChem CID 101218148) has the molecular formula C44H41B and a molecular weight of 580.62 g/mol. Its IUPAC name is 5-[2,6-bis(3,5-dimethylphenyl)phenyl]-6-(3,5-dimethylphenyl)-2,4-dimethylbenzo[b][1]benzoborole.
| Compound Name | 5-[2,6-bis(3,5-dimethylphenyl)phenyl]-6-(3,5-dimethylphenyl)-2,4-dimethylbenzo[b][1]benzoborole |
|---|---|
| PubChem CID | 101218148 |
| Molecular Formula | C44H41B |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 5-[2,6-bis(3,5-dimethylphenyl)phenyl]-6-(3,5-dimethylphenyl)-2,4-dimethylbenzo[b][1]benzoborole |
| SMILES | Cc1cc(C)cc(-c2cccc(-c3cc(C)cc(C)c3)c2B2c3c(C)cc(C)cc3-c3cccc(-c4cc(C)cc(C)c4)c32)c1 |
| InChI | InChI=1S/C44H41B/c1-26-15-27(2)20-34(19-26)37-11-9-12-38(35-21-28(3)16-29(4)22-35)43(37)45-42-33(8)18-32(7)25-41(42)40-14-10-13-39(44(40)45)36-23-30(5)17-31(6)24-36/h9-25H,1-8H3 |
| InChIKey | NNSBBFAAHKGACL-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|