C18H19N2+ — CID 176815409
(3aS,11bR)-1,2,3-trimethyl-3a,11b-dihydrophenanthro[9,10-d]imidazol-3-ium (PubChem CID 176815409) has the molecular formula C18H19N2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is (3aS,11bR)-1,2,3-trimethyl-3a,11b-dihydrophenanthro[9,10-d]imidazol-3-ium.
| Compound Name | (3aS,11bR)-1,2,3-trimethyl-3a,11b-dihydrophenanthro[9,10-d]imidazol-3-ium |
|---|---|
| PubChem CID | 176815409 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3aS,11bR)-1,2,3-trimethyl-3a,11b-dihydrophenanthro[9,10-d]imidazol-3-ium |
| SMILES | CC1=[N+](C)[C@H]2c3ccccc3-c3ccccc3[C@H]2N1C |
| InChI | InChI=1S/C18H19N2/c1-12-19(2)17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)18(17)20(12)3/h4-11,17-18H,1-3H3/q+1/t17-,18+ |
| InChIKey | OEZONESJVJIHRO-HDICACEKSA-N |
| XLogP | 3.46 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|