About lithium 9-ethyl-9H-fluorene
lithium 9-ethyl-9H-fluorene (PubChem CID 23225742) has the molecular formula C15H14Li+
and a molecular weight of 201.22 g/mol. Its IUPAC name is lithium 9-ethyl-9H-fluorene.
Molecular Properties
| Compound Name | lithium 9-ethyl-9H-fluorene |
| PubChem CID | 23225742 |
| Molecular Formula | C15H14Li+ |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | lithium 9-ethyl-9H-fluorene |
| SMILES | CCC1c2ccccc2-c2ccccc21.[Li+] |
| InChI | InChI=1S/C15H14.Li/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;/h3-11H,2H2,1H3;/q;+1 |
| InChIKey | UGIBFUTVPFVBAB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium 9-ethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 9-ethyl-9H-fluorene?
The IUPAC name of lithium 9-ethyl-9H-fluorene (CID 23225742) is lithium 9-ethyl-9H-fluorene.
What is the SMILES notation for lithium 9-ethyl-9H-fluorene?
The canonical SMILES for lithium 9-ethyl-9H-fluorene is CCC1c2ccccc2-c2ccccc21.[Li+].
What is the InChIKey of lithium 9-ethyl-9H-fluorene?
The InChIKey is UGIBFUTVPFVBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.Li/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;/h3-11H,2H2,1H3;/q;+1.
What are the key properties of lithium 9-ethyl-9H-fluorene?
lithium 9-ethyl-9H-fluorene has a molecular weight of 201.22 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 9-ethyl-9H-fluorene is sourced from PubChem (CID 23225742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).