About ethane;ethenol;9-ethyl-9H-fluorene
ethane;ethenol;9-ethyl-9H-fluorene (PubChem CID 142934939) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is ethane;ethenol;9-ethyl-9H-fluorene.
Molecular Properties
| Compound Name | ethane;ethenol;9-ethyl-9H-fluorene |
| PubChem CID | 142934939 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | ethane;ethenol;9-ethyl-9H-fluorene |
| SMILES | C=CO.CC.CCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H14.C2H4O.C2H6/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;1-2-3;1-2/h3-11H,2H2,1H3;2-3H,1H2;1-2H3 |
| InChIKey | GDALHBBHNCJKID-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethenol;9-ethyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethenol;9-ethyl-9H-fluorene?
The IUPAC name of ethane;ethenol;9-ethyl-9H-fluorene (CID 142934939) is ethane;ethenol;9-ethyl-9H-fluorene.
What is the SMILES notation for ethane;ethenol;9-ethyl-9H-fluorene?
The canonical SMILES for ethane;ethenol;9-ethyl-9H-fluorene is C=CO.CC.CCC1c2ccccc2-c2ccccc21.
What is the InChIKey of ethane;ethenol;9-ethyl-9H-fluorene?
The InChIKey is GDALHBBHNCJKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14.C2H4O.C2H6/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15;1-2-3;1-2/h3-11H,2H2,1H3;2-3H,1H2;1-2H3.
What are the key properties of ethane;ethenol;9-ethyl-9H-fluorene?
ethane;ethenol;9-ethyl-9H-fluorene has a molecular weight of 268.40 g/mol, XLogP of 5.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethenol;9-ethyl-9H-fluorene is sourced from PubChem (CID 142934939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).