C30H33N2+ — CID 152792747
2,3-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4H-pyrrolo[2,3-a]indolizin-5-ium (PubChem CID 152792747) has the molecular formula C30H33N2+ and a molecular weight of 421.61 g/mol. Its IUPAC name is 2,3-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4H-pyrrolo[2,3-a]indolizin-5-ium.
| Compound Name | 2,3-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4H-pyrrolo[2,3-a]indolizin-5-ium |
|---|---|
| PubChem CID | 152792747 |
| Molecular Formula | C30H33N2+ |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 2,3-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-4H-pyrrolo[2,3-a]indolizin-5-ium |
| SMILES | Cc1c2c(n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)c1C)-c1cccc[n+]1C2 |
| InChI | InChI=1S/C30H33N2/c1-19(2)25-16-24(23-12-8-7-9-13-23)17-26(20(3)4)29(25)32-22(6)21(5)27-18-31-15-11-10-14-28(31)30(27)32/h7-17,19-20H,18H2,1-6H3/q+1 |
| InChIKey | BSIHCVXPZKUNCF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|