C31H37N2+ — CID 123211062
2-[3,5-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium (PubChem CID 123211062) has the molecular formula C31H37N2+ and a molecular weight of 437.65 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[3,5-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 123211062 |
| Molecular Formula | C31H37N2+ |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 2-[3,5-dimethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)cc(C)n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)[n+](C)c1 |
| InChI | InChI=1S/C31H37N2/c1-20(2)27-17-26(25-12-10-9-11-13-25)18-28(21(3)4)31(27)33-24(7)16-23(6)30(33)29-15-14-22(5)19-32(29)8/h9-21H,1-8H3/q+1 |
| InChIKey | QVEQXWXMCQDLCI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|