C30H34FN2+ — CID 123700280
2-[5-fluoro-3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium (PubChem CID 123700280) has the molecular formula C30H34FN2+ and a molecular weight of 441.61 g/mol. Its IUPAC name is 2-[5-fluoro-3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[5-fluoro-3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 123700280 |
| Molecular Formula | C30H34FN2+ |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[5-fluoro-3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)cc(F)n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)[n+](C)c1 |
| InChI | InChI=1S/C30H34FN2/c1-19(2)25-16-24(23-11-9-8-10-12-23)17-26(20(3)4)30(25)33-28(31)15-22(6)29(33)27-14-13-21(5)18-32(27)7/h8-20H,1-7H3/q+1 |
| InChIKey | PYVARCWRWATZHB-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|