C30H32F3N2+ — CID 176787460
1-methyl-2-[2-methyl-6-(trifluoromethyl)phenyl]-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrazol-1-ium (PubChem CID 176787460) has the molecular formula C30H32F3N2+ and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-6-(trifluoromethyl)phenyl]-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrazol-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-6-(trifluoromethyl)phenyl]-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrazol-1-ium |
|---|---|
| PubChem CID | 176787460 |
| Molecular Formula | C30H32F3N2+ |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-methyl-2-[2-methyl-6-(trifluoromethyl)phenyl]-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrazol-1-ium |
| SMILES | Cc1cccc(C(F)(F)F)c1-n1cc(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c[n+]1C |
| InChI | InChI=1S/C30H32F3N2/c1-19(2)25-15-23(22-12-8-7-9-13-22)16-26(20(3)4)28(25)24-17-34(6)35(18-24)29-21(5)11-10-14-27(29)30(31,32)33/h7-20H,1-6H3/q+1 |
| InChIKey | MKOFNTKGMGCMSZ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|