C37H38N3+ — CID 148974380
7-methyl-1-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-2-phenylindole (PubChem CID 148974380) has the molecular formula C37H38N3+ and a molecular weight of 524.73 g/mol. Its IUPAC name is 7-methyl-1-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-2-phenylindole.
| Compound Name | 7-methyl-1-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-2-phenylindole |
|---|---|
| PubChem CID | 148974380 |
| Molecular Formula | C37H38N3+ |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 7-methyl-1-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-2-phenylindole |
| SMILES | Cc1cccc2cc(-c3ccccc3)n(-c3n(-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)cc[n+]3C)c12 |
| InChI | InChI=1S/C37H38N3/c1-25(2)32-22-31(28-15-9-7-10-16-28)23-33(26(3)4)36(32)39-21-20-38(6)37(39)40-34(29-17-11-8-12-18-29)24-30-19-13-14-27(5)35(30)40/h7-26H,1-6H3/q+1 |
| InChIKey | NOESWRAUOLKBLU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|