C29H36N3+ — CID 158725369
2-but-2-en-2-yl-1-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methylindole (PubChem CID 158725369) has the molecular formula C29H36N3+ and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-but-2-en-2-yl-1-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methylindole.
| Compound Name | 2-but-2-en-2-yl-1-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methylindole |
|---|---|
| PubChem CID | 158725369 |
| Molecular Formula | C29H36N3+ |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 2-but-2-en-2-yl-1-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]-7-methylindole |
| SMILES | CC=C(C)c1cc2cccc(C)c2n1-c1n(-c2c(C(C)C)cccc2C(C)C)cc[n+]1C |
| InChI | InChI=1S/C29H36N3/c1-9-21(6)26-18-23-13-10-12-22(7)27(23)32(26)29-30(8)16-17-31(29)28-24(19(2)3)14-11-15-25(28)20(4)5/h9-20H,1-8H3/q+1 |
| InChIKey | CSUVLTPMOUXHPN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|