C18H24N2O2 — CID 122389572
2-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]acetate (PubChem CID 122389572) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]acetate.
| Compound Name | 2-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]acetate |
|---|---|
| PubChem CID | 122389572 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[1-[2,6-di(propan-2-yl)phenyl]-3-methylimidazol-3-ium-2-yl]acetate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](C)c1CC(=O)[O-] |
| InChI | InChI=1S/C18H24N2O2/c1-12(2)14-7-6-8-15(13(3)4)18(14)20-10-9-19(5)16(20)11-17(21)22/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | PTUKEFBHXLKCBK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|