C23H26N3O3+ — CID 102575515
2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone (PubChem CID 102575515) has the molecular formula C23H26N3O3+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 102575515 |
| Molecular Formula | C23H26N3O3+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-nitrophenyl)ethanone |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](CC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C23H26N3O3/c1-16(2)20-6-5-7-21(17(3)4)23(20)25-13-12-24(15-25)14-22(27)18-8-10-19(11-9-18)26(28)29/h5-13,15-17H,14H2,1-4H3/q+1 |
| InChIKey | OSLSZKPVSOJGHV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|