C13H13N4O4S+ — CID 167313320
1-(4-nitrophenyl)-2-[1-(1-oxothietan-3-yl)-1,2,4-triazol-4-ium-4-yl]ethanone (PubChem CID 167313320) has the molecular formula C13H13N4O4S+ and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-[1-(1-oxothietan-3-yl)-1,2,4-triazol-4-ium-4-yl]ethanone.
| Compound Name | 1-(4-nitrophenyl)-2-[1-(1-oxothietan-3-yl)-1,2,4-triazol-4-ium-4-yl]ethanone |
|---|---|
| PubChem CID | 167313320 |
| Molecular Formula | C13H13N4O4S+ |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-(4-nitrophenyl)-2-[1-(1-oxothietan-3-yl)-1,2,4-triazol-4-ium-4-yl]ethanone |
| SMILES | O=C(C[n+]1cnn(C2CS(=O)C2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N4O4S/c18-13(10-1-3-11(4-2-10)17(19)20)5-15-8-14-16(9-15)12-6-22(21)7-12/h1-4,8-9,12H,5-7H2/q+1 |
| InChIKey | SYAULRWGYCWPKV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|