C37H37N4+ — CID 159719171
8-methyl-9-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene (PubChem CID 159719171) has the molecular formula C37H37N4+ and a molecular weight of 537.73 g/mol. Its IUPAC name is 8-methyl-9-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene.
| Compound Name | 8-methyl-9-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene |
|---|---|
| PubChem CID | 159719171 |
| Molecular Formula | C37H37N4+ |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 8-methyl-9-[1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene |
| SMILES | Cc1c(-c2n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)cc[n+]2C)c2c(nc3n2C=CC3)c2ccccc12 |
| InChI | InChI=1S/C37H37N4/c1-23(2)30-21-27(26-13-8-7-9-14-26)22-31(24(3)4)35(30)41-20-19-39(6)37(41)33-25(5)28-15-10-11-16-29(28)34-36(33)40-18-12-17-32(40)38-34/h7-16,18-24H,17H2,1-6H3/q+1 |
| InChIKey | LPLVHPMJUTWTKL-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|