C22H27N2+ — CID 164740248
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-3-methyl-2-phenylimidazol-3-ium (PubChem CID 164740248) has the molecular formula C22H27N2+ and a molecular weight of 321.48 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-3-methyl-2-phenylimidazol-3-ium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-3-methyl-2-phenylimidazol-3-ium |
|---|---|
| PubChem CID | 164740248 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-3-methyl-2-phenylimidazol-3-ium |
| SMILES | [2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1cc[n+](C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H27N2/c1-16(2)19-12-9-13-20(17(3)4)21(19)24-15-14-23(5)22(24)18-10-7-6-8-11-18/h6-17H,1-5H3/q+1/i16D,17D |
| InChIKey | UWBAAJACPMRNPU-OSLBFGEZSA-N |
| XLogP | 5.22 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|