C25H26N2 — CID 166043849
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole (PubChem CID 166043849) has the molecular formula C25H26N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 166043849 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole |
| SMILES | [2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C25H26N2/c1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19/h5-18H,1-4H3/i17D,18D |
| InChIKey | ZXBAOQTZRMQRGD-IUKNHUCNSA-N |
| XLogP | 6.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |