C26H25N3 — CID 169301226
3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzonitrile (PubChem CID 169301226) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzonitrile.
| Compound Name | 3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 169301226 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]benzonitrile |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2cccc(C#N)c2)nc2ccccc21 |
| InChI | InChI=1S/C26H25N3/c1-17(2)21-11-8-12-22(18(3)4)25(21)29-24-14-6-5-13-23(24)28-26(29)20-10-7-9-19(15-20)16-27/h5-15,17-18H,1-4H3 |
| InChIKey | BDRSRNWEWFOOMA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |