C63H60N4 — CID 140593746
1-[2,6-di(propan-2-yl)phenyl]-2-[3-[[3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenyl]-diphenylmethyl]phenyl]benzimidazole (PubChem CID 140593746) has the molecular formula C63H60N4 and a molecular weight of 873.20 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2-[3-[[3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenyl]-diphenylmethyl]phenyl]benzimidazole.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2-[3-[[3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenyl]-diphenylmethyl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 140593746 |
| Molecular Formula | C63H60N4 |
| Molecular Weight | 873.20 g/mol |
| Exact Mass | 872.48 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2-[3-[[3-[1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenyl]-diphenylmethyl]phenyl]benzimidazole |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2cccc(C(c3ccccc3)(c3ccccc3)c3cccc(-c4nc5ccccc5n4-c4c(C(C)C)cccc4C(C)C)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C63H60N4/c1-41(2)51-31-21-32-52(42(3)4)59(51)66-57-37-17-15-35-55(57)64-61(66)45-23-19-29-49(39-45)63(47-25-11-9-12-26-47,48-27-13-10-14-28-48)50-30-20-24-46(40-50)62-65-56-36-16-18-38-58(56)67(62)60-53(43(5)6)33-22-34-54(60)44(7)8/h9-44H,1-8H3 |
| InChIKey | MKYBRLNKJMFINQ-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.20 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|