C32H32N2 — CID 167338968
1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-(1,1,1,2,3,3-hexadeuteriopropan-2-yl)phenyl]-2-[3-phenyl-4-(trideuteriomethyl)phenyl]benzimidazole (PubChem CID 167338968) has the molecular formula C32H32N2 and a molecular weight of 460.72 g/mol. Its IUPAC name is 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-(1,1,1,2,3,3-hexadeuteriopropan-2-yl)phenyl]-2-[3-phenyl-4-(trideuteriomethyl)phenyl]benzimidazole.
| Compound Name | 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-(1,1,1,2,3,3-hexadeuteriopropan-2-yl)phenyl]-2-[3-phenyl-4-(trideuteriomethyl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 167338968 |
| Molecular Formula | C32H32N2 |
| Molecular Weight | 460.72 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-(1,1,1,2,3,3-hexadeuteriopropan-2-yl)phenyl]-2-[3-phenyl-4-(trideuteriomethyl)phenyl]benzimidazole |
| SMILES | [2H]C([2H])C([2H])(c1cccc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1-n1c(-c2ccc(C([2H])([2H])[2H])c(-c3ccccc3)c2)nc2ccccc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C32H32N2/c1-21(2)26-14-11-15-27(22(3)4)31(26)34-30-17-10-9-16-29(30)33-32(34)25-19-18-23(5)28(20-25)24-12-7-6-8-13-24/h6-22H,1-5H3/i1D2,2D3,3D3,4D3,5D3,21D,22D |
| InChIKey | OWWFRPWMMLVHOQ-VZOKXQBQSA-N |
| XLogP | 8.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.72 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |