C33H36N3+ — CID 123147889
1-methyl-2-[3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-3-phenylimidazol-1-ium (PubChem CID 123147889) has the molecular formula C33H36N3+ and a molecular weight of 474.67 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-3-phenylimidazol-1-ium.
| Compound Name | 1-methyl-2-[3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 123147889 |
| Molecular Formula | C33H36N3+ |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 1-methyl-2-[3-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyrrol-2-yl]-3-phenylimidazol-1-ium |
| SMILES | Cc1ccn(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C33H36N3/c1-23(2)29-21-27(26-13-9-7-10-14-26)22-30(24(3)4)32(29)36-18-17-25(5)31(36)33-34(6)19-20-35(33)28-15-11-8-12-16-28/h7-24H,1-6H3/q+1 |
| InChIKey | TUFQYOFXQHOMRL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|